About methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate
methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate (PubChem CID 145375801) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate |
| PubChem CID | 145375801 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate |
| SMILES | COC(=O)/C=C/CC[C@@H]1OC(=O)C=C[C@H]1O |
| InChI | InChI=1S/C11H14O5/c1-15-10(13)5-3-2-4-9-8(12)6-7-11(14)16-9/h3,5-9,12H,2,4H2,1H3/b5-3+/t8-,9+/m1/s1 |
| InChIKey | UDDJXKFOZILXNY-ZHBVTVBMSA-N |
| XLogP | 0.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate?
The IUPAC name of methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate (CID 145375801) is methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate.
What is the SMILES notation for methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate?
The canonical SMILES for methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate is COC(=O)/C=C/CC[C@@H]1OC(=O)C=C[C@H]1O.
What is the InChIKey of methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate?
The InChIKey is UDDJXKFOZILXNY-ZHBVTVBMSA-N. The full InChI is InChI=1S/C11H14O5/c1-15-10(13)5-3-2-4-9-8(12)6-7-11(14)16-9/h3,5-9,12H,2,4H2,1H3/b5-3+/t8-,9+/m1/s1.
What are the key properties of methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate?
methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate has a molecular weight of 226.23 g/mol, XLogP of 0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-5-[(2S,3R)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]pent-2-enoate is sourced from PubChem (CID 145375801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).