C20H25F3N2O4 — CID 145377156
2-[hydroxy-[4-[1-(2,4,5-trifluorophenoxy)ethyl]piperidin-1-yl]methyl]-7-oxa-5-azaspiro[3.4]octan-6-one (PubChem CID 145377156) has the molecular formula C20H25F3N2O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[hydroxy-[4-[1-(2,4,5-trifluorophenoxy)ethyl]piperidin-1-yl]methyl]-7-oxa-5-azaspiro[3.4]octan-6-one.
| Compound Name | 2-[hydroxy-[4-[1-(2,4,5-trifluorophenoxy)ethyl]piperidin-1-yl]methyl]-7-oxa-5-azaspiro[3.4]octan-6-one |
|---|---|
| PubChem CID | 145377156 |
| Molecular Formula | C20H25F3N2O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[hydroxy-[4-[1-(2,4,5-trifluorophenoxy)ethyl]piperidin-1-yl]methyl]-7-oxa-5-azaspiro[3.4]octan-6-one |
| SMILES | CC(Oc1cc(F)c(F)cc1F)C1CCN(C(O)C2CC3(COC(=O)N3)C2)CC1 |
| InChI | InChI=1S/C20H25F3N2O4/c1-11(29-17-7-15(22)14(21)6-16(17)23)12-2-4-25(5-3-12)18(26)13-8-20(9-13)10-28-19(27)24-20/h6-7,11-13,18,26H,2-5,8-10H2,1H3,(H,24,27) |
| InChIKey | FTHIWLCYRNEMTL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|