C56H51N3 — CID 145377212
2-[3,5-bis(9,9-dimethylfluoren-3-yl)phenyl]-3,6-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine;ethane (PubChem CID 145377212) has the molecular formula C56H51N3 and a molecular weight of 766.05 g/mol. Its IUPAC name is 2-[3,5-bis(9,9-dimethylfluoren-3-yl)phenyl]-3,6-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine;ethane.
| Compound Name | 2-[3,5-bis(9,9-dimethylfluoren-3-yl)phenyl]-3,6-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine;ethane |
|---|---|
| PubChem CID | 145377212 |
| Molecular Formula | C56H51N3 |
| Molecular Weight | 766.05 g/mol |
| Exact Mass | 765.41 |
| IUPAC Name | 2-[3,5-bis(9,9-dimethylfluoren-3-yl)phenyl]-3,6-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine;ethane |
| SMILES | CC.CC1(C)c2ccccc2-c2cc(-c3cc(-c4ccc5c(c4)-c4ccccc4C5(C)C)cc(C4NC5=C(NCC(c6ccccc6)=C5)N4c4ccccc4)c3)ccc21 |
| InChI | InChI=1S/C54H45N3.C2H6/c1-53(2)46-21-13-11-19-42(46)44-30-35(23-25-48(44)53)37-27-38(36-24-26-49-45(31-36)43-20-12-14-22-47(43)54(49,3)4)29-39(28-37)51-56-50-32-40(34-15-7-5-8-16-34)33-55-52(50)57(51)41-17-9-6-10-18-41;1-2/h5-32,51,55-56H,33H2,1-4H3;1-2H3 |
| InChIKey | DJIBTYVWVITKBA-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.05 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |