About ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one
ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 145378002) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one.
Molecular Properties
| Compound Name | ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one |
| PubChem CID | 145378002 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)C(=O)C1O.CC |
| InChI | InChI=1S/C10H16O2.C2H6/c1-6(2)8-5-4-7(3)9(11)10(8)12;1-2/h7-8,10,12H,1,4-5H2,2-3H3;1-2H3/t7-,8+,10?;/m1./s1 |
| InChIKey | NOVKFAYNPBWMNX-VSEBBIQCSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one?
The IUPAC name of ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one (CID 145378002) is ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one.
What is the SMILES notation for ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one?
The canonical SMILES for ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one is C=C(C)[C@@H]1CC[C@@H](C)C(=O)C1O.CC.
What is the InChIKey of ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one?
The InChIKey is NOVKFAYNPBWMNX-VSEBBIQCSA-N. The full InChI is InChI=1S/C10H16O2.C2H6/c1-6(2)8-5-4-7(3)9(11)10(8)12;1-2/h7-8,10,12H,1,4-5H2,2-3H3;1-2H3/t7-,8+,10?;/m1./s1.
What are the key properties of ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one?
ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one has a molecular weight of 198.31 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;trans-(3S,6R)-2-hydroxy-6-methyl-3-prop-1-en-2-ylcyclohexan-1-one is sourced from PubChem (CID 145378002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).