C30H35ClFN5O — CID 145378381
3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-diethylpropan-1-amine (PubChem CID 145378381) has the molecular formula C30H35ClFN5O and a molecular weight of 536.10 g/mol. Its IUPAC name is 3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-diethylpropan-1-amine.
| Compound Name | 3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 145378381 |
| Molecular Formula | C30H35ClFN5O |
| Molecular Weight | 536.10 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 3-[6-chloro-8-fluoro-4-(3-methylpiperazin-1-yl)-7-naphthalen-1-ylquinazolin-2-yl]oxy-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1nc(N2CCNC(C)C2)c2cc(Cl)c(-c3cccc4ccccc34)c(F)c2n1 |
| InChI | InChI=1S/C30H35ClFN5O/c1-4-36(5-2)15-9-17-38-30-34-28-24(29(35-30)37-16-14-33-20(3)19-37)18-25(31)26(27(28)32)23-13-8-11-21-10-6-7-12-22(21)23/h6-8,10-13,18,20,33H,4-5,9,14-17,19H2,1-3H3 |
| InChIKey | RCJJWHILYWXYSC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.10 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|