C31H40BF3N4O4 — CID 145378505
methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-[2-(cyclohexen-1-yl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate (PubChem CID 145378505) has the molecular formula C31H40BF3N4O4 and a molecular weight of 600.49 g/mol. Its IUPAC name is methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-[2-(cyclohexen-1-yl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate.
| Compound Name | methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-[2-(cyclohexen-1-yl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate |
|---|---|
| PubChem CID | 145378505 |
| Molecular Formula | C31H40BF3N4O4 |
| Molecular Weight | 600.49 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-[2-(cyclohexen-1-yl)ethyl]-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate |
| SMILES | C/C=C(\N=C(/OC)C1CCCN1/C(=B/OC#N)NC(=O)OC(C)(C)C)c1ccc(CCC2=CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H40BF3N4O4/c1-6-25(23-17-16-22(24(19-23)31(33,34)35)15-14-21-11-8-7-9-12-21)37-27(41-5)26-13-10-18-39(26)28(32-42-20-36)38-29(40)43-30(2,3)4/h6,11,16-17,19,26H,7-10,12-15,18H2,1-5H3,(H,38,40)/b25-6-,37-27- |
| InChIKey | KFIWSRYSTZWVOB-SUWYXEESSA-N |
| XLogP | 6.74 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.49 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|