About [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite
[4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite (PubChem CID 145378514) has the molecular formula C9H5F3IN3O2
and a molecular weight of 371.06 g/mol. Its IUPAC name is [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite.
Molecular Properties
| Compound Name | [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite |
| PubChem CID | 145378514 |
| Molecular Formula | C9H5F3IN3O2 |
| Molecular Weight | 371.06 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite |
| SMILES | Nc1nc(-c2ccc(OI)c(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C9H5F3IN3O2/c10-9(11,12)5-3-4(1-2-6(5)17-13)7-15-8(14)18-16-7/h1-3H,(H2,14,15,16) |
| InChIKey | BPMKSSFOMWPOSH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.06 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
The IUPAC name of [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite (CID 145378514) is [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite.
What is the SMILES notation for [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
The canonical SMILES for [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite is Nc1nc(-c2ccc(OI)c(C(F)(F)F)c2)no1.
What is the InChIKey of [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
The InChIKey is BPMKSSFOMWPOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F3IN3O2/c10-9(11,12)5-3-4(1-2-6(5)17-13)7-15-8(14)18-16-7/h1-3H,(H2,14,15,16).
What are the key properties of [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
[4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite has a molecular weight of 371.06 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-amino-1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite is sourced from PubChem (CID 145378514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).