About [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite
[4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite (PubChem CID 145378643) has the molecular formula C9H4F3IN2O2
and a molecular weight of 356.04 g/mol. Its IUPAC name is [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite.
Molecular Properties
| Compound Name | [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite |
| PubChem CID | 145378643 |
| Molecular Formula | C9H4F3IN2O2 |
| Molecular Weight | 356.04 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite |
| SMILES | FC(F)(F)c1cc(-c2ncon2)ccc1OI |
| InChI | InChI=1S/C9H4F3IN2O2/c10-9(11,12)6-3-5(1-2-7(6)17-13)8-14-4-16-15-8/h1-4H |
| InChIKey | ANHBFISXLPFZSG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.04 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
The IUPAC name of [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite (CID 145378643) is [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite.
What is the SMILES notation for [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
The canonical SMILES for [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite is FC(F)(F)c1cc(-c2ncon2)ccc1OI.
What is the InChIKey of [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
The InChIKey is ANHBFISXLPFZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3IN2O2/c10-9(11,12)6-3-5(1-2-7(6)17-13)8-14-4-16-15-8/h1-4H.
What are the key properties of [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite?
[4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite has a molecular weight of 356.04 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2,4-oxadiazol-3-yl)-2-(trifluoromethyl)phenyl] hypoiodite is sourced from PubChem (CID 145378643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).