C20H20FN3O3S — CID 1453789
5-[(3S)-1-benzylsulfonylpiperidin-3-yl]-3-(4-fluorophenyl)-1,2,4-oxadiazole (PubChem CID 1453789) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is 5-[(3S)-1-benzylsulfonylpiperidin-3-yl]-3-(4-fluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(3S)-1-benzylsulfonylpiperidin-3-yl]-3-(4-fluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 1453789 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-[(3S)-1-benzylsulfonylpiperidin-3-yl]-3-(4-fluorophenyl)-1,2,4-oxadiazole |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCC[C@H](c2nc(-c3ccc(F)cc3)no2)C1 |
| InChI | InChI=1S/C20H20FN3O3S/c21-18-10-8-16(9-11-18)19-22-20(27-23-19)17-7-4-12-24(13-17)28(25,26)14-15-5-2-1-3-6-15/h1-3,5-6,8-11,17H,4,7,12-14H2/t17-/m0/s1 |
| InChIKey | GORVCJLRJSSJQF-KRWDZBQOSA-N |
| XLogP | 3.59 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |