About cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene
cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene (PubChem CID 145378951) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene.
Molecular Properties
| Compound Name | cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene |
| PubChem CID | 145378951 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene |
| SMILES | COc1cc(F)ccc1C.NC1CC1 |
| InChI | InChI=1S/C8H9FO.C3H7N/c1-6-3-4-7(9)5-8(6)10-2;4-3-1-2-3/h3-5H,1-2H3;3H,1-2,4H2 |
| InChIKey | NYFVVPYMQBLLDH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene?
The IUPAC name of cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene (CID 145378951) is cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene.
What is the SMILES notation for cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene?
The canonical SMILES for cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene is COc1cc(F)ccc1C.NC1CC1.
What is the InChIKey of cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene?
The InChIKey is NYFVVPYMQBLLDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO.C3H7N/c1-6-3-4-7(9)5-8(6)10-2;4-3-1-2-3/h3-5H,1-2H3;3H,1-2,4H2.
What are the key properties of cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene?
cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene has a molecular weight of 197.25 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanamine;4-fluoro-2-methoxy-1-methylbenzene is sourced from PubChem (CID 145378951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).