C15H29F3N2O8 — CID 145379649
2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylazanium;2,2,2-trifluoroacetate (PubChem CID 145379649) has the molecular formula C15H29F3N2O8 and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylazanium;2,2,2-trifluoroacetate.
| Compound Name | 2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 145379649 |
| Molecular Formula | C15H29F3N2O8 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[NH3+]CCOCCOCCOCCOCCOCCNC=O |
| InChI | InChI=1S/C13H28N2O6.C2HF3O2/c14-1-3-17-5-7-19-9-11-21-12-10-20-8-6-18-4-2-15-13-16;3-2(4,5)1(6)7/h13H,1-12,14H2,(H,15,16);(H,6,7) |
| InChIKey | NYXVFVBUMIIJNO-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|