C17H28N6OS — CID 145380219
[(1R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]ethyl] (N'-ethylcarbamimidoyl)sulfanylmethanimidate (PubChem CID 145380219) has the molecular formula C17H28N6OS and a molecular weight of 364.52 g/mol. Its IUPAC name is [(1R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]ethyl] (N'-ethylcarbamimidoyl)sulfanylmethanimidate.
| Compound Name | [(1R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]ethyl] (N'-ethylcarbamimidoyl)sulfanylmethanimidate |
|---|---|
| PubChem CID | 145380219 |
| Molecular Formula | C17H28N6OS |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(1R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]ethyl] (N'-ethylcarbamimidoyl)sulfanylmethanimidate |
| SMILES | [H]/N=C(/O[C@H](C)C1CCN(c2ncc(CC)cn2)CC1)S/C(N)=N/CC |
| InChI | InChI=1S/C17H28N6OS/c1-4-13-10-21-17(22-11-13)23-8-6-14(7-9-23)12(3)24-16(19)25-15(18)20-5-2/h10-12,14,19H,4-9H2,1-3H3,(H2,18,20)/b19-16-/t12-/m1/s1 |
| InChIKey | XDJFNWMHEUIFSV-QCJHYCHESA-N |
| XLogP | 2.66 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|