About methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine
methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine (PubChem CID 145380317) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine.
Molecular Properties
| Compound Name | methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine |
| PubChem CID | 145380317 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine |
| SMILES | CC1=CCN=C(N2CCCCC2)N=C1.CO |
| InChI | InChI=1S/C11H17N3.CH4O/c1-10-5-6-12-11(13-9-10)14-7-3-2-4-8-14;1-2/h5,9H,2-4,6-8H2,1H3;2H,1H3 |
| InChIKey | YFBRFAZBFOUPNS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine?
The IUPAC name of methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine (CID 145380317) is methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine.
What is the SMILES notation for methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine?
The canonical SMILES for methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine is CC1=CCN=C(N2CCCCC2)N=C1.CO.
What is the InChIKey of methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine?
The InChIKey is YFBRFAZBFOUPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3.CH4O/c1-10-5-6-12-11(13-9-10)14-7-3-2-4-8-14;1-2/h5,9H,2-4,6-8H2,1H3;2H,1H3.
What are the key properties of methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine?
methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine has a molecular weight of 223.32 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;6-methyl-2-piperidin-1-yl-4H-1,3-diazepine is sourced from PubChem (CID 145380317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).