C16H31NO3 — CID 145380408
pentane;propan-2-yl 4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 145380408) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is pentane;propan-2-yl 4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | pentane;propan-2-yl 4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 145380408 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | pentane;propan-2-yl 4-(2-hydroxyethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CC=C(CCO)CC1.CCCCC |
| InChI | InChI=1S/C11H19NO3.C5H12/c1-9(2)15-11(14)12-6-3-10(4-7-12)5-8-13;1-3-5-4-2/h3,9,13H,4-8H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | CYKCXMWXJOJGNN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|