About ethane;(Z)-2-(ethylamino)but-2-enal
ethane;(Z)-2-(ethylamino)but-2-enal (PubChem CID 145380426) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is ethane;(Z)-2-(ethylamino)but-2-enal.
Molecular Properties
| Compound Name | ethane;(Z)-2-(ethylamino)but-2-enal |
| PubChem CID | 145380426 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | ethane;(Z)-2-(ethylamino)but-2-enal |
| SMILES | C/C=C(/C=O)NCC.CC |
| InChI | InChI=1S/C6H11NO.C2H6/c1-3-6(5-8)7-4-2;1-2/h3,5,7H,4H2,1-2H3;1-2H3/b6-3-; |
| InChIKey | YZKAIXQACDDHCS-AQPBACSKSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-2-(ethylamino)but-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-2-(ethylamino)but-2-enal?
The IUPAC name of ethane;(Z)-2-(ethylamino)but-2-enal (CID 145380426) is ethane;(Z)-2-(ethylamino)but-2-enal.
What is the SMILES notation for ethane;(Z)-2-(ethylamino)but-2-enal?
The canonical SMILES for ethane;(Z)-2-(ethylamino)but-2-enal is C/C=C(/C=O)NCC.CC.
What is the InChIKey of ethane;(Z)-2-(ethylamino)but-2-enal?
The InChIKey is YZKAIXQACDDHCS-AQPBACSKSA-N. The full InChI is InChI=1S/C6H11NO.C2H6/c1-3-6(5-8)7-4-2;1-2/h3,5,7H,4H2,1-2H3;1-2H3/b6-3-;.
What are the key properties of ethane;(Z)-2-(ethylamino)but-2-enal?
ethane;(Z)-2-(ethylamino)but-2-enal has a molecular weight of 143.23 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-2-(ethylamino)but-2-enal is sourced from PubChem (CID 145380426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).