C18H13N3S — CID 145380929
4,6-diphenylthieno[3,2-d]pyrimidin-2-amine (PubChem CID 145380929) has the molecular formula C18H13N3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 4,6-diphenylthieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4,6-diphenylthieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 145380929 |
| Molecular Formula | C18H13N3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4,6-diphenylthieno[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c2sc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C18H13N3S/c19-18-20-14-11-15(12-7-3-1-4-8-12)22-17(14)16(21-18)13-9-5-2-6-10-13/h1-11H,(H2,19,20,21) |
| InChIKey | YGXDLIDLIRFDBB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |