About (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole
(E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole (PubChem CID 145381540) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole.
Molecular Properties
| Compound Name | (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole |
| PubChem CID | 145381540 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole |
| SMILES | C/C=C/C.C/C=C\c1nc[nH]c1C.CC |
| InChI | InChI=1S/C7H10N2.C4H8.C2H6/c1-3-4-7-6(2)8-5-9-7;1-3-4-2;1-2/h3-5H,1-2H3,(H,8,9);3-4H,1-2H3;1-2H3/b4-3-;4-3+; |
| InChIKey | LKSVTSCCJCLQKA-XYYYSBKPSA-N |
| XLogP | 4.36 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole?
The IUPAC name of (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole (CID 145381540) is (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole.
What is the SMILES notation for (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole?
The canonical SMILES for (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole is C/C=C/C.C/C=C\c1nc[nH]c1C.CC.
What is the InChIKey of (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole?
The InChIKey is LKSVTSCCJCLQKA-XYYYSBKPSA-N. The full InChI is InChI=1S/C7H10N2.C4H8.C2H6/c1-3-4-7-6(2)8-5-9-7;1-3-4-2;1-2/h3-5H,1-2H3,(H,8,9);3-4H,1-2H3;1-2H3/b4-3-;4-3+;.
What are the key properties of (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole?
(E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole has a molecular weight of 208.35 g/mol, XLogP of 4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-ene;ethane;5-methyl-4-[(Z)-prop-1-enyl]-1H-imidazole is sourced from PubChem (CID 145381540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).