About 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine
2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine (PubChem CID 14538166) has the molecular formula C23H22F3NO2S
and a molecular weight of 433.50 g/mol. Its IUPAC name is 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine.
Molecular Properties
| Compound Name | 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine |
| PubChem CID | 14538166 |
| Molecular Formula | C23H22F3NO2S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine |
| SMILES | CCOc1ccc(C(CSCc2cccc(Oc3ccccc3)n2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22F3NO2S/c1-2-28-19-13-11-17(12-14-19)21(23(24,25)26)16-30-15-18-7-6-10-22(27-18)29-20-8-4-3-5-9-20/h3-14,21H,2,15-16H2,1H3 |
| InChIKey | MVUOLCVICOXNSW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine?
The IUPAC name of 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine (CID 14538166) is 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine.
What is the SMILES notation for 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine?
The canonical SMILES for 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine is CCOc1ccc(C(CSCc2cccc(Oc3ccccc3)n2)C(F)(F)F)cc1.
What is the InChIKey of 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine?
The InChIKey is MVUOLCVICOXNSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F3NO2S/c1-2-28-19-13-11-17(12-14-19)21(23(24,25)26)16-30-15-18-7-6-10-22(27-18)29-20-8-4-3-5-9-20/h3-14,21H,2,15-16H2,1H3.
What are the key properties of 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine?
2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine has a molecular weight of 433.50 g/mol, XLogP of 6.85, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-ethoxyphenyl)-3,3,3-trifluoropropyl]sulfanylmethyl]-6-phenoxypyridine is sourced from PubChem (CID 14538166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).