C36H39N7O2 — CID 145381785
3-[2-[4-(diethylamino)phenyl]-1-[(3-methoxyphenyl)methyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide (PubChem CID 145381785) has the molecular formula C36H39N7O2 and a molecular weight of 601.76 g/mol. Its IUPAC name is 3-[2-[4-(diethylamino)phenyl]-1-[(3-methoxyphenyl)methyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide.
| Compound Name | 3-[2-[4-(diethylamino)phenyl]-1-[(3-methoxyphenyl)methyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 145381785 |
| Molecular Formula | C36H39N7O2 |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | 3-[2-[4-(diethylamino)phenyl]-1-[(3-methoxyphenyl)methyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide |
| SMILES | CCN(CC)c1ccc(-c2nc3cc(C(CC(N)=O)NCc4ccc5[nH]ncc5c4)ccc3n2Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C36H39N7O2/c1-4-42(5-2)29-13-10-26(11-14-29)36-40-33-19-27(12-16-34(33)43(36)23-25-7-6-8-30(18-25)45-3)32(20-35(37)44)38-21-24-9-15-31-28(17-24)22-39-41-31/h6-19,22,32,38H,4-5,20-21,23H2,1-3H3,(H2,37,44)(H,39,41) |
| InChIKey | JYUICNLIWDTEIW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|