About ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide
ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide (PubChem CID 145381829) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide.
Molecular Properties
| Compound Name | ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide |
| PubChem CID | 145381829 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide |
| SMILES | C=C/C(=C\N=C(/C)N)C(=C)C.CC |
| InChI | InChI=1S/C9H14N2.C2H6/c1-5-9(7(2)3)6-11-8(4)10;1-2/h5-6H,1-2H2,3-4H3,(H2,10,11);1-2H3/b9-6+; |
| InChIKey | KWMUKPPMMUWCTH-MLBSPLJJSA-N |
| XLogP | 3.04 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
The IUPAC name of ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide (CID 145381829) is ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide.
What is the SMILES notation for ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
The canonical SMILES for ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide is C=C/C(=C\N=C(/C)N)C(=C)C.CC.
What is the InChIKey of ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
The InChIKey is KWMUKPPMMUWCTH-MLBSPLJJSA-N. The full InChI is InChI=1S/C9H14N2.C2H6/c1-5-9(7(2)3)6-11-8(4)10;1-2/h5-6H,1-2H2,3-4H3,(H2,10,11);1-2H3/b9-6+;.
What are the key properties of ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide has a molecular weight of 180.29 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide is sourced from PubChem (CID 145381829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).