About N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide
N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide (PubChem CID 145381830) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide |
| PubChem CID | 145381830 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide |
| SMILES | C=C/C(=C\N=C(/C)N)C(=C)C |
| InChI | InChI=1S/C9H14N2/c1-5-9(7(2)3)6-11-8(4)10/h5-6H,1-2H2,3-4H3,(H2,10,11)/b9-6+ |
| InChIKey | SNQYQQLCJWWRHZ-RMKNXTFCSA-N |
| XLogP | 2.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
The IUPAC name of N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide (CID 145381830) is N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide.
What is the SMILES notation for N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
The canonical SMILES for N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide is C=C/C(=C\N=C(/C)N)C(=C)C.
What is the InChIKey of N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
The InChIKey is SNQYQQLCJWWRHZ-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H14N2/c1-5-9(7(2)3)6-11-8(4)10/h5-6H,1-2H2,3-4H3,(H2,10,11)/b9-6+.
What are the key properties of N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide?
N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide has a molecular weight of 150.22 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1E)-2-ethenyl-3-methylbuta-1,3-dienyl]ethanimidamide is sourced from PubChem (CID 145381830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).