C23H22IN5O3S — CID 145382091
2-[1-[5-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]triazol-4-yl]ethynyl thiohypoiodite (PubChem CID 145382091) has the molecular formula C23H22IN5O3S and a molecular weight of 575.43 g/mol. Its IUPAC name is 2-[1-[5-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]triazol-4-yl]ethynyl thiohypoiodite.
| Compound Name | 2-[1-[5-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]triazol-4-yl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 145382091 |
| Molecular Formula | C23H22IN5O3S |
| Molecular Weight | 575.43 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 2-[1-[5-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]pent-4-ynyl]triazol-4-yl]ethynyl thiohypoiodite |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(C#CCCCn3cc(C#CSI)nn3)cccc2C1=O |
| InChI | InChI=1S/C23H22IN5O3S/c1-25-22(31)21(10-6-13-30)29-16-20-17(8-5-9-19(20)23(29)32)7-3-2-4-12-28-15-18(26-27-28)11-14-33-24/h5,8-9,13,15,21H,2,4,6,10,12,16H2,1H3,(H,25,31) |
| InChIKey | ARVAWEWPGCKQCA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|