About methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol
methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol (PubChem CID 145382668) has the molecular formula C12H29NO7S
and a molecular weight of 331.43 g/mol. Its IUPAC name is methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol.
Molecular Properties
| Compound Name | methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol |
| PubChem CID | 145382668 |
| Molecular Formula | C12H29NO7S |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol |
| SMILES | CC(C)OC1CC(O)C(O)C(C)O1.CNS(C)(=O)=O.CO |
| InChI | InChI=1S/C9H18O4.C2H7NO2S.CH4O/c1-5(2)12-8-4-7(10)9(11)6(3)13-8;1-3-6(2,4)5;1-2/h5-11H,4H2,1-3H3;3H,1-2H3;2H,1H3 |
| InChIKey | ZXEUEJBOIJBMBR-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol?
The IUPAC name of methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol (CID 145382668) is methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol.
What is the SMILES notation for methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol?
The canonical SMILES for methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol is CC(C)OC1CC(O)C(O)C(C)O1.CNS(C)(=O)=O.CO.
What is the InChIKey of methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol?
The InChIKey is ZXEUEJBOIJBMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4.C2H7NO2S.CH4O/c1-5(2)12-8-4-7(10)9(11)6(3)13-8;1-3-6(2,4)5;1-2/h5-11H,4H2,1-3H3;3H,1-2H3;2H,1H3.
What are the key properties of methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol?
methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol has a molecular weight of 331.43 g/mol, XLogP of -0.96, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;N-methylmethanesulfonamide;2-methyl-6-propan-2-yloxyoxane-3,4-diol is sourced from PubChem (CID 145382668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).