C14H10Cl2N2 — CID 145382700
(1Z,2E,4Z,6E)-2,6-dichloro-3,4-bis(ethenyl)-1,5-benzodiazocine (PubChem CID 145382700) has the molecular formula C14H10Cl2N2 and a molecular weight of 277.15 g/mol. Its IUPAC name is (1Z,2E,4Z,6E)-2,6-dichloro-3,4-bis(ethenyl)-1,5-benzodiazocine.
| Compound Name | (1Z,2E,4Z,6E)-2,6-dichloro-3,4-bis(ethenyl)-1,5-benzodiazocine |
|---|---|
| PubChem CID | 145382700 |
| Molecular Formula | C14H10Cl2N2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (1Z,2E,4Z,6E)-2,6-dichloro-3,4-bis(ethenyl)-1,5-benzodiazocine |
| SMILES | C=CC1=N/C(Cl)=c2/cccc/c2=N/C(Cl)=C\1C=C |
| InChI | InChI=1S/C14H10Cl2N2/c1-3-9-11(4-2)17-14(16)10-7-5-6-8-12(10)18-13(9)15/h3-8H,1-2H2/b11-9-,13-9-,14-10-,17-11-,17-14+,18-12-,18-13+ |
| InChIKey | KWBQWSHRGJGDFM-DUSQDDIISA-N |
| XLogP | 2.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|