About 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine
1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine (PubChem CID 145382882) has the molecular formula C24H56N4O2
and a molecular weight of 432.74 g/mol. Its IUPAC name is 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine.
Molecular Properties
| Compound Name | 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine |
| PubChem CID | 145382882 |
| Molecular Formula | C24H56N4O2 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 432.44 |
| IUPAC Name | 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine |
| SMILES | CC.CC.CC(C)C1CNCCO1.CC(C)C1COCCN1.CC1CNCCN1C |
| InChI | InChI=1S/2C7H15NO.C6H14N2.2C2H6/c1-6(2)7-5-9-4-3-8-7;1-6(2)7-5-8-3-4-9-7;1-6-5-7-3-4-8(6)2;2*1-2/h2*6-8H,3-5H2,1-2H3;6-7H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | OXEKDDFJOSKWBB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine?
The IUPAC name of 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine (CID 145382882) is 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine.
What is the SMILES notation for 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine?
The canonical SMILES for 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine is CC.CC.CC(C)C1CNCCO1.CC(C)C1COCCN1.CC1CNCCN1C.
What is the InChIKey of 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine?
The InChIKey is OXEKDDFJOSKWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H15NO.C6H14N2.2C2H6/c1-6(2)7-5-9-4-3-8-7;1-6(2)7-5-8-3-4-9-7;1-6-5-7-3-4-8(6)2;2*1-2/h2*6-8H,3-5H2,1-2H3;6-7H,3-5H2,1-2H3;2*1-2H3.
What are the key properties of 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine?
1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine has a molecular weight of 432.74 g/mol, XLogP of 3.22, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperazine;ethane;2-propan-2-ylmorpholine;3-propan-2-ylmorpholine is sourced from PubChem (CID 145382882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).