About 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid
5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid (PubChem CID 145383285) has the molecular formula C23H19FN6O4
and a molecular weight of 462.44 g/mol. Its IUPAC name is 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid.
Molecular Properties
| Compound Name | 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid |
| PubChem CID | 145383285 |
| Molecular Formula | C23H19FN6O4 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid |
| SMILES | CC.N#Cc1ccc(-n2nccn2)c(C(=O)O)c1.O=C(O)c1ccc(F)cc1-c1ncccn1 |
| InChI | InChI=1S/C11H7FN2O2.C10H6N4O2.C2H6/c12-7-2-3-8(11(15)16)9(6-7)10-13-4-1-5-14-10;11-6-7-1-2-9(8(5-7)10(15)16)14-12-3-4-13-14;1-2/h1-6H,(H,15,16);1-5H,(H,15,16);1-2H3 |
| InChIKey | LSEAABYXTSLTLF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 154.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid?
The IUPAC name of 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid (CID 145383285) is 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid.
What is the SMILES notation for 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid?
The canonical SMILES for 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid is CC.N#Cc1ccc(-n2nccn2)c(C(=O)O)c1.O=C(O)c1ccc(F)cc1-c1ncccn1.
What is the InChIKey of 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid?
The InChIKey is LSEAABYXTSLTLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FN2O2.C10H6N4O2.C2H6/c12-7-2-3-8(11(15)16)9(6-7)10-13-4-1-5-14-10;11-6-7-1-2-9(8(5-7)10(15)16)14-12-3-4-13-14;1-2/h1-6H,(H,15,16);1-5H,(H,15,16);1-2H3.
What are the key properties of 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid?
5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid has a molecular weight of 462.44 g/mol, XLogP of 3.84, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-2-(triazol-2-yl)benzoic acid;ethane;4-fluoro-2-pyrimidin-2-ylbenzoic acid is sourced from PubChem (CID 145383285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).