About 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane
2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane (PubChem CID 145383928) has the molecular formula C22H27NO
and a molecular weight of 321.46 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane |
| PubChem CID | 145383928 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane |
| SMILES | C=CC1=C(C=C)N(c2ccccc2)c2ccccc2O1.CC.CC |
| InChI | InChI=1S/C18H15NO.2C2H6/c1-3-15-17(4-2)20-18-13-9-8-12-16(18)19(15)14-10-6-5-7-11-14;2*1-2/h3-13H,1-2H2;2*1-2H3 |
| InChIKey | YWEBAJYSNYLAPI-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane?
The IUPAC name of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane (CID 145383928) is 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane.
What is the SMILES notation for 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane?
The canonical SMILES for 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane is C=CC1=C(C=C)N(c2ccccc2)c2ccccc2O1.CC.CC.
What is the InChIKey of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane?
The InChIKey is YWEBAJYSNYLAPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO.2C2H6/c1-3-15-17(4-2)20-18-13-9-8-12-16(18)19(15)14-10-6-5-7-11-14;2*1-2/h3-13H,1-2H2;2*1-2H3.
What are the key properties of 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane?
2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane has a molecular weight of 321.46 g/mol, XLogP of 6.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-4-phenyl-1,4-benzoxazine;ethane is sourced from PubChem (CID 145383928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).