About methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane
methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane (PubChem CID 145384541) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane.
Analyze methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane?
The IUPAC name of methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane (CID 145384541) is methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane.
What is the SMILES notation for methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane?
The canonical SMILES for methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane is CCC.COC(=O)C1=C(C)C(=O)CCC1(C)C.
What is the InChIKey of methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane?
The InChIKey is RZIWXBSLESHMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3.C3H8/c1-7-8(12)5-6-11(2,3)9(7)10(13)14-4;1-3-2/h5-6H2,1-4H3;3H2,1-2H3.
What are the key properties of methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane?
methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane has a molecular weight of 240.34 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6,6-trimethyl-3-oxocyclohexene-1-carboxylate;propane is sourced from PubChem (CID 145384541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).