C13H12N2O4 — CID 145384978
methyl 6-formyl-4-oxo-3,7,8,8a-tetrahydropyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 145384978) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is methyl 6-formyl-4-oxo-3,7,8,8a-tetrahydropyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | methyl 6-formyl-4-oxo-3,7,8,8a-tetrahydropyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 145384978 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | methyl 6-formyl-4-oxo-3,7,8,8a-tetrahydropyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)C(=O)C=C1C2CCN1C=O |
| InChI | InChI=1S/C13H12N2O4/c1-19-13(18)9-4-8-7-2-3-15(6-16)10(7)5-11(17)12(8)14-9/h4-7,14H,2-3H2,1H3 |
| InChIKey | WTTQAZZLMUCGMT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|