C15H15F6NO5 — CID 145385004
ethane;methanol;4-(2,2,2-trifluoroacetyl)-2-[4-(trifluoromethoxy)phenyl]-4H-1,3-oxazol-5-one (PubChem CID 145385004) has the molecular formula C15H15F6NO5 and a molecular weight of 403.28 g/mol. Its IUPAC name is ethane;methanol;4-(2,2,2-trifluoroacetyl)-2-[4-(trifluoromethoxy)phenyl]-4H-1,3-oxazol-5-one.
| Compound Name | ethane;methanol;4-(2,2,2-trifluoroacetyl)-2-[4-(trifluoromethoxy)phenyl]-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 145385004 |
| Molecular Formula | C15H15F6NO5 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | ethane;methanol;4-(2,2,2-trifluoroacetyl)-2-[4-(trifluoromethoxy)phenyl]-4H-1,3-oxazol-5-one |
| SMILES | CC.CO.O=C1OC(c2ccc(OC(F)(F)F)cc2)=NC1C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H5F6NO4.C2H6.CH4O/c13-11(14,15)8(20)7-10(21)22-9(19-7)5-1-3-6(4-2-5)23-12(16,17)18;2*1-2/h1-4,7H;1-2H3;2H,1H3 |
| InChIKey | UDCJIIUALBSLDS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|