C24H32N4 — CID 145385150
6-(4-heptan-4-ylphenyl)-4-piperazin-1-ylpyrrolo[1,2-b]pyridazine (PubChem CID 145385150) has the molecular formula C24H32N4 and a molecular weight of 376.55 g/mol. Its IUPAC name is 6-(4-heptan-4-ylphenyl)-4-piperazin-1-ylpyrrolo[1,2-b]pyridazine.
| Compound Name | 6-(4-heptan-4-ylphenyl)-4-piperazin-1-ylpyrrolo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 145385150 |
| Molecular Formula | C24H32N4 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 6-(4-heptan-4-ylphenyl)-4-piperazin-1-ylpyrrolo[1,2-b]pyridazine |
| SMILES | CCCC(CCC)c1ccc(-c2cc3c(N4CCNCC4)ccnn3c2)cc1 |
| InChI | InChI=1S/C24H32N4/c1-3-5-19(6-4-2)20-7-9-21(10-8-20)22-17-24-23(11-12-26-28(24)18-22)27-15-13-25-14-16-27/h7-12,17-19,25H,3-6,13-16H2,1-2H3 |
| InChIKey | QKHIWKKZPYUCTG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |