C11H17BrF2N2 — CID 145385253
2-N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-3,3-difluoro-1-N,2-N-dimethylpropane-1,2-diamine (PubChem CID 145385253) has the molecular formula C11H17BrF2N2 and a molecular weight of 295.17 g/mol. Its IUPAC name is 2-N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-3,3-difluoro-1-N,2-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-3,3-difluoro-1-N,2-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 145385253 |
| Molecular Formula | C11H17BrF2N2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-N-[(3Z)-5-bromohexa-1,3,5-trien-2-yl]-3,3-difluoro-1-N,2-N-dimethylpropane-1,2-diamine |
| SMILES | C=C(Br)/C=C\C(=C)N(C)C(CNC)C(F)F |
| InChI | InChI=1S/C11H17BrF2N2/c1-8(12)5-6-9(2)16(4)10(7-15-3)11(13)14/h5-6,10-11,15H,1-2,7H2,3-4H3/b6-5- |
| InChIKey | YNAGFYFBMRFCHU-WAYWQWQTSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|