C13H32N2O — CID 145385314
N'-(3-methoxypropyl)-N,N'-dimethylpropane-1,3-diamine;2-methylprop-1-ene;molecular hydrogen (PubChem CID 145385314) has the molecular formula C13H32N2O and a molecular weight of 232.41 g/mol. Its IUPAC name is N'-(3-methoxypropyl)-N,N'-dimethylpropane-1,3-diamine;2-methylprop-1-ene;molecular hydrogen.
| Compound Name | N'-(3-methoxypropyl)-N,N'-dimethylpropane-1,3-diamine;2-methylprop-1-ene;molecular hydrogen |
|---|---|
| PubChem CID | 145385314 |
| Molecular Formula | C13H32N2O |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.25 |
| IUPAC Name | N'-(3-methoxypropyl)-N,N'-dimethylpropane-1,3-diamine;2-methylprop-1-ene;molecular hydrogen |
| SMILES | C=C(C)C.CNCCCN(C)CCCOC.[H][H] |
| InChI | InChI=1S/C9H22N2O.C4H8.H2/c1-10-6-4-7-11(2)8-5-9-12-3;1-4(2)3;/h10H,4-9H2,1-3H3;1H2,2-3H3;1H |
| InChIKey | PRCHJUWOCPSHPQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|