C35H64OS — CID 145385669
ethane;(E,7Z)-7-ethylidene-8-(2-methylprop-2-enoxy)-10-[4-(4-pentylcyclohexyl)cyclohexyl]dec-8-ene-1-thiol (PubChem CID 145385669) has the molecular formula C35H64OS and a molecular weight of 532.96 g/mol. Its IUPAC name is ethane;(E,7Z)-7-ethylidene-8-(2-methylprop-2-enoxy)-10-[4-(4-pentylcyclohexyl)cyclohexyl]dec-8-ene-1-thiol.
| Compound Name | ethane;(E,7Z)-7-ethylidene-8-(2-methylprop-2-enoxy)-10-[4-(4-pentylcyclohexyl)cyclohexyl]dec-8-ene-1-thiol |
|---|---|
| PubChem CID | 145385669 |
| Molecular Formula | C35H64OS |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.47 |
| IUPAC Name | ethane;(E,7Z)-7-ethylidene-8-(2-methylprop-2-enoxy)-10-[4-(4-pentylcyclohexyl)cyclohexyl]dec-8-ene-1-thiol |
| SMILES | C=C(C)COC(=C/CC1CCC(C2CCC(CCCCC)CC2)CC1)/C(=C\C)CCCCCCS.CC |
| InChI | InChI=1S/C33H58OS.C2H6/c1-5-7-10-13-28-15-20-31(21-16-28)32-22-17-29(18-23-32)19-24-33(34-26-27(3)4)30(6-2)14-11-8-9-12-25-35;1-2/h6,24,28-29,31-32,35H,3,5,7-23,25-26H2,1-2,4H3;1-2H3/b30-6-,33-24+; |
| InChIKey | BIEKEGIKEJAWCB-YGTWFUEXSA-N |
| XLogP | 11.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|