C34H58OS — CID 145385671
(7Z)-7-[(E)-1-(2-methylprop-2-enoxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-1-enyl]deca-7,9-diene-1-thiol (PubChem CID 145385671) has the molecular formula C34H58OS and a molecular weight of 514.90 g/mol. Its IUPAC name is (7Z)-7-[(E)-1-(2-methylprop-2-enoxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-1-enyl]deca-7,9-diene-1-thiol.
| Compound Name | (7Z)-7-[(E)-1-(2-methylprop-2-enoxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-1-enyl]deca-7,9-diene-1-thiol |
|---|---|
| PubChem CID | 145385671 |
| Molecular Formula | C34H58OS |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.42 |
| IUPAC Name | (7Z)-7-[(E)-1-(2-methylprop-2-enoxy)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-1-enyl]deca-7,9-diene-1-thiol |
| SMILES | C=C/C=C(CCCCCCS)\C(=C/CC1CCC(C2CCC(CCCCC)CC2)CC1)OCC(=C)C |
| InChI | InChI=1S/C34H58OS/c1-5-7-10-14-29-16-21-31(22-17-29)32-23-18-30(19-24-32)20-25-34(35-27-28(3)4)33(13-6-2)15-11-8-9-12-26-36/h6,13,25,29-32,36H,2-3,5,7-12,14-24,26-27H2,1,4H3/b33-13-,34-25+ |
| InChIKey | OWLLDIOYFNCIBS-OKLJVSMDSA-N |
| XLogP | 11.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|