C18H23N5OS — CID 145386180
6-methoxy-N-[[(Z)-2-(methylideneamino)-2-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)ethenyl]sulfanylmethyl]pyridin-3-amine (PubChem CID 145386180) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 6-methoxy-N-[[(Z)-2-(methylideneamino)-2-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)ethenyl]sulfanylmethyl]pyridin-3-amine.
| Compound Name | 6-methoxy-N-[[(Z)-2-(methylideneamino)-2-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)ethenyl]sulfanylmethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 145386180 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6-methoxy-N-[[(Z)-2-(methylideneamino)-2-(2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl)ethenyl]sulfanylmethyl]pyridin-3-amine |
| SMILES | C=N/C(=C\SCNc1ccc(OC)nc1)c1c(C)nc2n1CCCC2 |
| InChI | InChI=1S/C18H23N5OS/c1-13-18(23-9-5-4-6-16(23)22-13)15(19-2)11-25-12-21-14-7-8-17(24-3)20-10-14/h7-8,10-11,21H,2,4-6,9,12H2,1,3H3/b15-11- |
| InChIKey | JUZAZLASQXMSSE-PTNGSMBKSA-N |
| XLogP | 3.73 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|