C21H29ClN4O — CID 145386342
(1Z,3Z)-N-chloro-N-(methylideneamino)-5-[(2E,4E)-5-(3-phenylpropoxy)penta-2,4-dien-2-yl]iminopenta-1,3-dien-1-amine;methanamine (PubChem CID 145386342) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is (1Z,3Z)-N-chloro-N-(methylideneamino)-5-[(2E,4E)-5-(3-phenylpropoxy)penta-2,4-dien-2-yl]iminopenta-1,3-dien-1-amine;methanamine.
| Compound Name | (1Z,3Z)-N-chloro-N-(methylideneamino)-5-[(2E,4E)-5-(3-phenylpropoxy)penta-2,4-dien-2-yl]iminopenta-1,3-dien-1-amine;methanamine |
|---|---|
| PubChem CID | 145386342 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (1Z,3Z)-N-chloro-N-(methylideneamino)-5-[(2E,4E)-5-(3-phenylpropoxy)penta-2,4-dien-2-yl]iminopenta-1,3-dien-1-amine;methanamine |
| SMILES | C=NN(Cl)/C=C\C=C/C=N/C(C)=C/C=C/OCCCc1ccccc1.CN |
| InChI | InChI=1S/C20H24ClN3O.CH5N/c1-19(23-15-7-4-8-16-24(21)22-2)11-9-17-25-18-10-14-20-12-5-3-6-13-20;1-2/h3-9,11-13,15-17H,2,10,14,18H2,1H3;2H2,1H3/b7-4-,16-8-,17-9+,19-11+,23-15+; |
| InChIKey | CZGKKBGTJVZPCA-CUQYNPIJSA-N |
| XLogP | 4.84 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|