C28H30FN3O2 — CID 145386411
2-[[(1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-3-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-6-yl]amino]acetonitrile (PubChem CID 145386411) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[[(1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-3-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-6-yl]amino]acetonitrile.
| Compound Name | 2-[[(1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-3-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-6-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 145386411 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-[[(1R,3aR,4aR,8aR,9S,9aS)-9-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1-methyl-3-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-6-yl]amino]acetonitrile |
| SMILES | C[C@H]1OC(=O)[C@@H]2C[C@@H]3CC(NCC#N)CC[C@H]3[C@H](/C=C/c3ccc(-c4cccc(F)c4)cn3)[C@H]12 |
| InChI | InChI=1S/C28H30FN3O2/c1-17-27-25(10-7-22-6-5-19(16-32-22)18-3-2-4-21(29)13-18)24-9-8-23(31-12-11-30)14-20(24)15-26(27)28(33)34-17/h2-7,10,13,16-17,20,23-27,31H,8-9,12,14-15H2,1H3/b10-7+/t17-,20+,23?,24-,25+,26-,27+/m1/s1 |
| InChIKey | TXMLXPXQJHCZGV-NJZQHHLQSA-N |
| XLogP | 5.00 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|