About [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol
[(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol (PubChem CID 145386548) has the molecular formula C26H43NO2
and a molecular weight of 401.64 g/mol. Its IUPAC name is [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol.
Molecular Properties
| Compound Name | [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol |
| PubChem CID | 145386548 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol |
| SMILES | C(=C/C1CCCC1)\CCCc1ccccc1.C/C=C\CCCC(=O)NCC.CO |
| InChI | InChI=1S/C16H22.C9H17NO.CH4O/c1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16;1-3-5-6-7-8-9(11)10-4-2;1-2/h1,3-4,6,9-10,12,16H,2,5,7-8,11,13-14H2;3,5H,4,6-8H2,1-2H3,(H,10,11);2H,1H3/b12-6+;5-3-; |
| InChIKey | CWGWHUSRORBPMU-DDYALAOTSA-N |
| XLogP | 6.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol?
The IUPAC name of [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol (CID 145386548) is [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol.
What is the SMILES notation for [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol?
The canonical SMILES for [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol is C(=C/C1CCCC1)\CCCc1ccccc1.C/C=C\CCCC(=O)NCC.CO.
What is the InChIKey of [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol?
The InChIKey is CWGWHUSRORBPMU-DDYALAOTSA-N. The full InChI is InChI=1S/C16H22.C9H17NO.CH4O/c1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16;1-3-5-6-7-8-9(11)10-4-2;1-2/h1,3-4,6,9-10,12,16H,2,5,7-8,11,13-14H2;3,5H,4,6-8H2,1-2H3,(H,10,11);2H,1H3/b12-6+;5-3-;.
What are the key properties of [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol?
[(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol has a molecular weight of 401.64 g/mol, XLogP of 6.23, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5-cyclopentylpent-4-enyl]benzene;(Z)-N-ethylhept-5-enamide;methanol is sourced from PubChem (CID 145386548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).