C14H23FO — CID 145386644
(3Z,5E)-6-fluoro-2-methoxy-4-pentan-3-ylocta-1,3,5-triene (PubChem CID 145386644) has the molecular formula C14H23FO and a molecular weight of 226.33 g/mol. Its IUPAC name is (3Z,5E)-6-fluoro-2-methoxy-4-pentan-3-ylocta-1,3,5-triene.
| Compound Name | (3Z,5E)-6-fluoro-2-methoxy-4-pentan-3-ylocta-1,3,5-triene |
|---|---|
| PubChem CID | 145386644 |
| Molecular Formula | C14H23FO |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (3Z,5E)-6-fluoro-2-methoxy-4-pentan-3-ylocta-1,3,5-triene |
| SMILES | C=C(/C=C(\C=C(\F)CC)C(CC)CC)OC |
| InChI | InChI=1S/C14H23FO/c1-6-12(7-2)13(9-11(4)16-5)10-14(15)8-3/h9-10,12H,4,6-8H2,1-3,5H3/b13-9+,14-10+ |
| InChIKey | NKAWLMUJQHJODX-UTLPMFLDSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|