C34H51ClO5 — CID 145386668
(2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12,23-trimethyltetracosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid (PubChem CID 145386668) has the molecular formula C34H51ClO5 and a molecular weight of 575.23 g/mol. Its IUPAC name is (2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12,23-trimethyltetracosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid.
| Compound Name | (2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12,23-trimethyltetracosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid |
|---|---|
| PubChem CID | 145386668 |
| Molecular Formula | C34H51ClO5 |
| Molecular Weight | 575.23 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | (2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12,23-trimethyltetracosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid |
| SMILES | CC(/C=C/C=C/C(=O)O)=C\C=C\C=C(/Cl)[C@@H](C)CC[C@H](O)CC/C=C/C=C/CC(C)C.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C27H39ClO3.C7H12O2/c1-22(2)14-8-6-5-7-9-17-25(29)21-20-24(4)26(28)18-12-10-15-23(3)16-11-13-19-27(30)31;8-7(9)6-4-2-1-3-5-6/h5-8,10-13,15-16,18-19,22,24-25,29H,9,14,17,20-21H2,1-4H3,(H,30,31);6H,1-5H2,(H,8,9)/b7-5+,8-6+,12-10+,16-11+,19-13+,23-15+,26-18-;/t24-,25+;/m0./s1 |
| InChIKey | QQIISIIQTFTZPT-OGUFYBMDSA-N |
| XLogP | 9.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.23 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|