C34H52O5 — CID 145386670
cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10E,18E,20E)-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate (PubChem CID 145386670) has the molecular formula C34H52O5 and a molecular weight of 540.79 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10E,18E,20E)-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate.
| Compound Name | cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10E,18E,20E)-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate |
|---|---|
| PubChem CID | 145386670 |
| Molecular Formula | C34H52O5 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10E,18E,20E)-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate |
| SMILES | COC(=O)/C=C/C=C/C(C)=C/C=C/C=C/C(C)CCC(O)CC/C=C/C=C/C(C)C.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C27H40O3.C7H12O2/c1-23(2)15-9-6-7-12-19-26(28)22-21-25(4)17-11-8-10-16-24(3)18-13-14-20-27(29)30-5;8-7(9)6-4-2-1-3-5-6/h6-11,13-18,20,23,25-26,28H,12,19,21-22H2,1-5H3;6H,1-5H2,(H,8,9)/b7-6+,10-8+,15-9+,17-11+,18-13+,20-14+,24-16+; |
| InChIKey | OCITXFWNTQJUII-XQKGBNHWSA-N |
| XLogP | 8.31 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|