C32H47ClO5 — CID 145386672
cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12-dimethyldocosa-2,4,6,8,10,18,20-heptaenoate (PubChem CID 145386672) has the molecular formula C32H47ClO5 and a molecular weight of 547.18 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12-dimethyldocosa-2,4,6,8,10,18,20-heptaenoate.
| Compound Name | cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12-dimethyldocosa-2,4,6,8,10,18,20-heptaenoate |
|---|---|
| PubChem CID | 145386672 |
| Molecular Formula | C32H47ClO5 |
| Molecular Weight | 547.18 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | cyclohexanecarboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,15R,18E,20E)-11-chloro-15-hydroxy-6,12-dimethyldocosa-2,4,6,8,10,18,20-heptaenoate |
| SMILES | C/C=C/C=C/CC[C@@H](O)CC[C@H](C)/C(Cl)=C/C=C/C=C(C)/C=C/C=C/C(=O)OC.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C25H35ClO3.C7H12O2/c1-5-6-7-8-9-16-23(27)20-19-22(3)24(26)17-12-10-14-21(2)15-11-13-18-25(28)29-4;8-7(9)6-4-2-1-3-5-6/h5-8,10-15,17-18,22-23,27H,9,16,19-20H2,1-4H3;6H,1-5H2,(H,8,9)/b6-5+,8-7+,12-10+,15-11+,18-13+,21-14+,24-17-;/t22-,23+;/m0./s1 |
| InChIKey | LYNNJCXUQJNACV-QVPCJJJTSA-N |
| XLogP | 8.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.18 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|