C34H51ClO6 — CID 145386677
(1R)-3-hydroxycyclohexane-1-carboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,18E,20E)-11-chloro-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate (PubChem CID 145386677) has the molecular formula C34H51ClO6 and a molecular weight of 591.23 g/mol. Its IUPAC name is (1R)-3-hydroxycyclohexane-1-carboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,18E,20E)-11-chloro-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate.
| Compound Name | (1R)-3-hydroxycyclohexane-1-carboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,18E,20E)-11-chloro-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate |
|---|---|
| PubChem CID | 145386677 |
| Molecular Formula | C34H51ClO6 |
| Molecular Weight | 591.23 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | (1R)-3-hydroxycyclohexane-1-carboxylic acid;methyl (2E,4E,6E,8E,10Z,12S,18E,20E)-11-chloro-15-hydroxy-6,12,22-trimethyltricosa-2,4,6,8,10,18,20-heptaenoate |
| SMILES | COC(=O)/C=C/C=C/C(C)=C/C=C/C=C(\Cl)[C@@H](C)CCC(O)CC/C=C/C=C/C(C)C.O=C(O)[C@@H]1CCCC(O)C1 |
| InChI | InChI=1S/C27H39ClO3.C7H12O3/c1-22(2)14-8-6-7-9-17-25(29)21-20-24(4)26(28)18-12-10-15-23(3)16-11-13-19-27(30)31-5;8-6-3-1-2-5(4-6)7(9)10/h6-8,10-16,18-19,22,24-25,29H,9,17,20-21H2,1-5H3;5-6,8H,1-4H2,(H,9,10)/b7-6+,12-10+,14-8+,16-11+,19-13+,23-15+,26-18-;/t24-,25?;5-,6?/m01/s1 |
| InChIKey | JDXLVXCKDPYXLN-ZFPQDFPASA-N |
| XLogP | 7.84 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.23 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|