C34H51ClO5 — CID 145386681
(2E,4E,6E,8E,10Z,18E,20E)-11-chloro-15-hydroxy-6,12,22,22-tetramethyltricosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid (PubChem CID 145386681) has the molecular formula C34H51ClO5 and a molecular weight of 575.23 g/mol. Its IUPAC name is (2E,4E,6E,8E,10Z,18E,20E)-11-chloro-15-hydroxy-6,12,22,22-tetramethyltricosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid.
| Compound Name | (2E,4E,6E,8E,10Z,18E,20E)-11-chloro-15-hydroxy-6,12,22,22-tetramethyltricosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid |
|---|---|
| PubChem CID | 145386681 |
| Molecular Formula | C34H51ClO5 |
| Molecular Weight | 575.23 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | (2E,4E,6E,8E,10Z,18E,20E)-11-chloro-15-hydroxy-6,12,22,22-tetramethyltricosa-2,4,6,8,10,18,20-heptaenoic acid;cyclohexanecarboxylic acid |
| SMILES | CC(/C=C/C=C/C(=O)O)=C\C=C\C=C(/Cl)C(C)CCC(O)CC/C=C/C=C/C(C)(C)C.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C27H39ClO3.C7H12O2/c1-22(15-10-12-18-26(30)31)14-9-11-17-25(28)23(2)19-20-24(29)16-8-6-7-13-21-27(3,4)5;8-7(9)6-4-2-1-3-5-6/h6-7,9-15,17-18,21,23-24,29H,8,16,19-20H2,1-5H3,(H,30,31);6H,1-5H2,(H,8,9)/b7-6+,11-9+,15-10+,18-12+,21-13+,22-14+,25-17-; |
| InChIKey | TYDCGVNSRBECHW-KYVHGESPSA-N |
| XLogP | 9.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.23 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|