C17H21NO — CID 145387085
(2Z,5Z,9Z)-5-[(Z)-2-methoxyethenyl]-7,8-dimethylidenedodeca-2,5,9,11-tetraen-1-imine (PubChem CID 145387085) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (2Z,5Z,9Z)-5-[(Z)-2-methoxyethenyl]-7,8-dimethylidenedodeca-2,5,9,11-tetraen-1-imine.
| Compound Name | (2Z,5Z,9Z)-5-[(Z)-2-methoxyethenyl]-7,8-dimethylidenedodeca-2,5,9,11-tetraen-1-imine |
|---|---|
| PubChem CID | 145387085 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2Z,5Z,9Z)-5-[(Z)-2-methoxyethenyl]-7,8-dimethylidenedodeca-2,5,9,11-tetraen-1-imine |
| SMILES | [H]/N=C/C=C\CC(/C=C\OC)=C\C(=C)C(=C)/C=C\C=C |
| InChI | InChI=1S/C17H21NO/c1-5-6-9-15(2)16(3)14-17(11-13-19-4)10-7-8-12-18/h5-9,11-14,18H,1-3,10H2,4H3/b8-7-,9-6-,13-11-,17-14-,18-12+ |
| InChIKey | OGQGKEWHGNOIKW-OSRCLAPPSA-N |
| XLogP | 4.52 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|