C18H23FN2O2 — CID 145387473
tert-butyl N-[(3E)-4-(6-fluoro-3-pyridinyl)-6-methylhepta-1,3,5-trien-2-yl]carbamate (PubChem CID 145387473) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is tert-butyl N-[(3E)-4-(6-fluoro-3-pyridinyl)-6-methylhepta-1,3,5-trien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3E)-4-(6-fluoro-3-pyridinyl)-6-methylhepta-1,3,5-trien-2-yl]carbamate |
|---|---|
| PubChem CID | 145387473 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl N-[(3E)-4-(6-fluoro-3-pyridinyl)-6-methylhepta-1,3,5-trien-2-yl]carbamate |
| SMILES | C=C(/C=C(\C=C(C)C)c1ccc(F)nc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23FN2O2/c1-12(2)9-15(14-7-8-16(19)20-11-14)10-13(3)21-17(22)23-18(4,5)6/h7-11H,3H2,1-2,4-6H3,(H,21,22)/b15-10+ |
| InChIKey | HTANTYQOSXEVOY-XNTDXEJSSA-N |
| XLogP | 4.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|