C22H20O5 — CID 145387968
5-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoyl]-2,3,4-trihydroxy-6-methylcyclohepta-2,4,6-trien-1-one (PubChem CID 145387968) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 5-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoyl]-2,3,4-trihydroxy-6-methylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 5-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoyl]-2,3,4-trihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 145387968 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 5-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]benzoyl]-2,3,4-trihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C\C(=C/C)c1ccc(C(=O)c2c(C)cc(=O)c(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C22H20O5/c1-4-6-7-14(5-2)15-8-10-16(11-9-15)19(24)18-13(3)12-17(23)20(25)22(27)21(18)26/h4-12H,1H2,2-3H3,(H3,23,25,26,27)/b7-6-,14-5+ |
| InChIKey | VAXKPSNUGCONBY-WFRORPSUSA-N |
| XLogP | 3.85 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|