About 2-methoxyhexane-1,4,5-triol
2-methoxyhexane-1,4,5-triol (PubChem CID 145388583) has the molecular formula C7H16O4
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-methoxyhexane-1,4,5-triol.
Molecular Properties
| Compound Name | 2-methoxyhexane-1,4,5-triol |
| PubChem CID | 145388583 |
| Molecular Formula | C7H16O4 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 2-methoxyhexane-1,4,5-triol |
| SMILES | COC(CO)CC(O)C(C)O |
| InChI | InChI=1S/C7H16O4/c1-5(9)7(10)3-6(4-8)11-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | SPYNTTBKCSYQQU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxyhexane-1,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyhexane-1,4,5-triol?
The IUPAC name of 2-methoxyhexane-1,4,5-triol (CID 145388583) is 2-methoxyhexane-1,4,5-triol.
What is the SMILES notation for 2-methoxyhexane-1,4,5-triol?
The canonical SMILES for 2-methoxyhexane-1,4,5-triol is COC(CO)CC(O)C(C)O.
What is the InChIKey of 2-methoxyhexane-1,4,5-triol?
The InChIKey is SPYNTTBKCSYQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O4/c1-5(9)7(10)3-6(4-8)11-2/h5-10H,3-4H2,1-2H3.
What are the key properties of 2-methoxyhexane-1,4,5-triol?
2-methoxyhexane-1,4,5-triol has a molecular weight of 164.20 g/mol, XLogP of -0.87, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyhexane-1,4,5-triol is sourced from PubChem (CID 145388583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).