C30H49NO — CID 145388629
(NE)-N-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine (PubChem CID 145388629) has the molecular formula C30H49NO and a molecular weight of 439.73 g/mol. Its IUPAC name is (NE)-N-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 145388629 |
| Molecular Formula | C30H49NO |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.38 |
| IUPAC Name | (NE)-N-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC/C(=N\O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C30H49NO/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31-32)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25,32H,9,11-19H2,1-8H3/b31-26+/t21-,22-,25+,28-,29-,30+/m1/s1 |
| InChIKey | YPHKCWGCZVDNSV-IGKVEUBCSA-N |
| XLogP | 8.95 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|